Home
>
Catalysts and Ligands>Photocatalysts>
>
9-Mesityl-2,7,10-trimethylacridin-10-ium tetrafluoroborate
For research use only. Not for therapeutic Use.
9-Mesityl-2,7,10-trimethylacridin-10-ium tetrafluoroborate (Cat.No:L003790) is a significant compound in materials science. Its intricate acridine-based structure confers unique photophysical properties. This compound finds application in organic electronics, particularly in the development of optoelectronic devices. Its tailored electronic properties make it invaluable in the creation of advanced materials for various industries.
Catalog Number | L003790 |
CAS Number | 1621019-97-3 |
Molecular Formula | C25H26BF4N |
Purity | ≥95% |
IUPAC Name | 2,7,10-trimethyl-9-(2,4,6-trimethylphenyl)acridin-10-ium;tetrafluoroborate |
InChI | InChI=1S/C25H26N.BF4/c1-15-7-9-22-20(13-15)25(24-18(4)11-17(3)12-19(24)5)21-14-16(2)8-10-23(21)26(22)6;2-1(3,4)5/h7-14H,1-6H3;/q+1;-1 |
InChIKey | UCBSHEKJRRAYNP-UHFFFAOYSA-N |
SMILES | [B-](F)(F)(F)F.CC1=CC2=C(C=C1)[N+](=C3C=CC(=CC3=C2C4=C(C=C(C=C4C)C)C)C)C |