For research use only. Not for therapeutic Use.
9-Methylidenefluorene is an organic compound featuring a fluorene backbone with a methylene group at the ninth position. Known for its aromatic properties, it is utilized in organic synthesis and materials science. This compound is valuable in the development of organic semiconductors, light-emitting diodes (LEDs), and other advanced materials due to its unique electronic and structural characteristics.
CAS Number | 4425-82-5 |
Synonyms | 1,2:3,4-Dibenzofulvene; 9-Methylene-9H-fluorene; 9-Methylenefluorene; Dibenzfulvene; Dibenzofulvene; Fluorenylidenemethane |
Molecular Formula | C14H10 |
Purity | ≥95% |
Storage | Store at +4℃ |
IUPAC Name | 9-methylidenefluorene |
InChI | InChI=1S/C14H10/c1-10-11-6-2-4-8-13(11)14-9-5-3-7-12(10)14/h2-9H,1H2 |
InChIKey | ZYASLTYCYTYKFC-UHFFFAOYSA-N |
SMILES | C=C1C2=CC=CC=C2C3=CC=CC=C13 |