For research use only. Not for therapeutic Use.
9-Methylphenanthrene(Cat No.:R023185), is a chemical compound with the molecular formula C15H12. It features a phenanthrene ring structure with a methyl group (-CH3) attached at the ninth carbon position. This compound’s structure suggests its potential applications in organic synthesis and as a building block for creating diverse molecules. The presence of the methyl group on the phenanthrene ring can influence its reactivity, making it valuable for preparing specialized compounds used in pharmaceuticals, agrochemicals, and other fine chemicals.
Catalog Number | R023185 |
CAS Number | 883-20-5 |
Molecular Formula | C15H12 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 9-methylphenanthrene |
InChI | InChI=1S/C15H12/c1-11-10-12-6-2-3-8-14(12)15-9-5-4-7-13(11)15/h2-10H,1H3 |
InChIKey | DALBHIYZSZZWBS-UHFFFAOYSA-N |
SMILES | CC1=CC2=CC=CC=C2C3=CC=CC=C13 |