For research use only. Not for therapeutic Use.
9-Nitroanthracene-d9(Cat No.:I041480)is a deuterated version of 9-nitroanthracene, where hydrogen atoms are replaced by deuterium (D). This isotopic substitution makes it valuable in analytical chemistry, particularly for nuclear magnetic resonance (NMR) spectroscopy, where the deuterium signal helps eliminate interference from protons. The compound is used in the study of molecular interactions, photochemical reactions, and reaction mechanisms. Its nitro group also makes it useful for investigating environmental pollutants and tracking chemical transformations in complex systems. 9-Nitroanthracene-d9 serves as a key tool in both synthetic and analytical research.
CAS Number | 220381-38-4 |
Synonyms | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-nitroanthracene |
Molecular Formula | C14D9NO2 |
Purity | ≥95% |
IUPAC Name | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-nitroanthracene |
InChI | InChI=1S/C14H9NO2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
InChIKey | LSIKFJXEYJIZNB-LOIXRAQWSA-N |
SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(=C(C(=C(C3=C2[N+](=O)[O-])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |