For research use only. Not for therapeutic Use.
9-Phenyl-10-(phenylethynyl)anthracene (Cat.No:L003796) is a pivotal compound in materials science and optoelectronics. Its extended π-conjugation and phenyl-ethynyl substituents confer unique electronic properties, making it valuable in organic electronic devices. This compound serves as a key component in the development of organic semiconductors, highlighting its significance in the advancement of technologies like organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs).
Catalog Number | L003796 |
CAS Number | 97083-12-0 |
Molecular Formula | C28H18 |
Purity | ≥95% |
IUPAC Name | 9-phenyl-10-(2-phenylethynyl)anthracene |
InChI | InChI=1S/C28H18/c1-3-11-21(12-4-1)19-20-25-23-15-7-9-17-26(23)28(22-13-5-2-6-14-22)27-18-10-8-16-24(25)27/h1-18H |
InChIKey | YVRDYTIJRGATPR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C#CC2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=CC=C5 |