Home
>
Chemical Reagents>Organic Building Blocks> 9,10-[1,2]Benzenoanthracene-2,3,6,7,14,15(9H,10H)-hexaone
For research use only. Not for therapeutic Use.
9,10-[1,2]Benzenoanthracene-2,3,6,7,14,15(9H,10H)-hexaone (Cat.No:L003697) is a significant compound in materials science. Its intricate polycyclic structure offers diverse reactivity, making it valuable in the development of specialized materials with electronic and optoelectronic applications. This compound’s unique properties position it at the forefront of research in advanced materials and highlight its importance in the pursuit of innovative technologies across various industries.
CAS Number | 2253629-27-3 |
Molecular Formula | C20H8O6 |
Purity | ≥95% |
IUPAC Name | pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,6,9,13,15,19-hexaene-4,5,11,12,17,18-hexone |
InChI | InChI=1S/C20H8O6/c21-13-1-7-8(2-14(13)22)20-11-5-17(25)15(23)3-9(11)19(7)10-4-16(24)18(26)6-12(10)20/h1-6,19-20H |
InChIKey | UUBBBRDCXAHKBF-UHFFFAOYSA-N |
SMILES | 9,10-[1,2]Benzenoanthracene-2,3,6,7,14,15(9H,10H)-hexaone - CAS 2253629-27-3 |