For research use only. Not for therapeutic Use.
9,10-Bis(diethylphosphonomethyl)anthracene is an organic compound featuring an anthracene backbone with two diethylphosphonomethyl groups attached at the 9 and 10 positions. Its chemical formula is C₂₁H₃₃O₆P₂. This compound is of interest in materials science and organic chemistry due to its potential applications in photovoltaic devices and as a luminescent material. The phosphonomethyl groups enhance its solubility and reactivity, making it a valuable precursor for further modifi
Catalog Number | L047378 |
CAS Number | 60974-92-7 |
Molecular Formula | C24H32O6P2 |
Purity | ≥95% |
IUPAC Name | 9,10-bis(diethoxyphosphorylmethyl)anthracene |
InChI | InChI=1S/C24H32O6P2/c1-5-27-31(25,28-6-2)17-23-19-13-9-11-15-21(19)24(22-16-12-10-14-20(22)23)18-32(26,29-7-3)30-8-4/h9-16H,5-8,17-18H2,1-4H3 |
InChIKey | PKLFGXZSNISEOV-UHFFFAOYSA-N |
SMILES | CCOP(=O)(CC1=C2C=CC=CC2=C(C3=CC=CC=C31)CP(=O)(OCC)OCC)OCC |