For research use only. Not for therapeutic Use.
9,10-Dihydrophenanthrene is a high-purity compound used in organic synthesis and materials science. This hydrogenated phenanthrene derivative is essential for studying aromatic hydrocarbon chemistry and developing advanced materials. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, 9,10-Dihydrophenanthrene enhances research accuracy and efficiency.
Catalog Number | R023835 |
CAS Number | 776-35-2 |
Synonyms | 9,10-Dihydro-phenanthrene, ; NSC 60018 |
Molecular Formula | C14H12 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 9,10-dihydrophenanthrene |
InChI | InChI=1S/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-8H,9-10H2 |
InChIKey | XXPBFNVKTVJZKF-UHFFFAOYSA-N |
SMILES | C1CC2=CC=CC=C2C3=CC=CC=C31 |