For research use only. Not for therapeutic Use.
93-O17S(Cat No.:I041166)is a small molecule inhibitor that targets specific enzymes or signaling pathways involved in disease progression. Although details on its exact mechanism are still under investigation, 93-O17S has shown promise in preclinical studies for its potential to modulate cellular processes such as proliferation, survival, and apoptosis, particularly in cancer cells. This compound is being explored for its ability to interfere with key proteins or pathways associated with tumor growth and resistance to treatment. As research continues, 93-O17S may serve as a potential therapeutic candidate for cancer and other diseases requiring targeted intervention.
CAS Number | 2227008-67-3 |
Synonyms | 2-tetradecylsulfanylethyl 3-[3-imidazol-1-ylpropyl-[3-oxo-3-(2-tetradecylsulfanylethoxy)propyl]amino]propanoate |
Molecular Formula | C44H83N3O4S2 |
Purity | ≥95% |
IUPAC Name | 2-tetradecylsulfanylethyl 3-[3-imidazol-1-ylpropyl-[3-oxo-3-(2-tetradecylsulfanylethoxy)propyl]amino]propanoate |
InChI | InChI=1S/C44H83N3O4S2/c1-3-5-7-9-11-13-15-17-19-21-23-25-38-52-40-36-50-43(48)28-33-46(31-27-32-47-35-30-45-42-47)34-29-44(49)51-37-41-53-39-26-24-22-20-18-16-14-12-10-8-6-4-2/h30,35,42H,3-29,31-34,36-41H2,1-2H3 |
InChIKey | OLOIOPYNTGMAAP-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCSCCOC(=O)CCN(CCCN1C=CN=C1)CCC(=O)OCCSCCCCCCCCCCCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |