For research use only. Not for therapeutic Use.
9,9′-Bianthracene, 10,10′-bis([1,1′-biphenyl]-4-yl)-(Cat No.:M135552)is a complex aromatic compound with extended π-conjugation, making it valuable in materials science and organic electronics. The molecule’s structure features two anthracene units linked by biphenyl groups, enhancing its optical and electronic properties. It is widely used in the development of organic semiconductors, light-emitting diodes (OLEDs), and other advanced electronic devices. Known for its stability and high purity, this compound is essential for research and development in cutting-edge technologies requiring precise molecular engineering.
Catalog Number | M135552 |
CAS Number | 172285-79-9 |
Molecular Formula | C52H34 |
Purity | ≥95% |
IUPAC Name | 9-(4-phenylphenyl)-10-[10-(4-phenylphenyl)anthracen-9-yl]anthracene |
InChI | InChI=1S/C52H34/c1-3-15-35(16-4-1)37-27-31-39(32-28-37)49-41-19-7-11-23-45(41)51(46-24-12-8-20-42(46)49)52-47-25-13-9-21-43(47)50(44-22-10-14-26-48(44)52)40-33-29-38(30-34-40)36-17-5-2-6-18-36/h1-34H |
InChIKey | KIQHGZHPNCGQJY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=C4C=CC=CC4=C(C5=CC=CC=C53)C6=C7C=CC=CC7=C(C8=CC=CC=C86)C9=CC=C(C=C9)C1=CC=CC=C1 |