For research use only. Not for therapeutic Use.
9,9-Dioctylfluorene-2,7-diboronic acid bis(pinacol) ester (Cat No.:R015001) is a chemical compound. It is a derivative of fluorene containing two boronic acid functional groups substituted at positions 2 and 7, protected with pinacol ester groups. This compound is commonly used in organic synthesis as a versatile building block for the preparation of various functional materials, such as conjugated polymers, OLEDs (organic light-emitting diodes), and other electronic and optoelectronic devices. Its unique structure enables efficient coupling reactions with other molecules, making it valuable in the field of materials chemistry and electronics.
CAS Number | 196207-58-6 |
Synonyms | 2,2’-(9,9-Dioctyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]?2,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9-di-n-octylfluorene?2,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9-dioctylfluorene |
Molecular Formula | C41H64B2O4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-[9,9-dioctyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C41H64B2O4/c1-11-13-15-17-19-21-27-41(28-22-20-18-16-14-12-2)35-29-31(42-44-37(3,4)38(5,6)45-42)23-25-33(35)34-26-24-32(30-36(34)41)43-46-39(7,8)40(9,10)47-43/h23-26,29-30H,11-22,27-28H2,1-10H3 |
InChIKey | FAHIZHKRQQNPLC-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=C(C3(CCCCCCCC)CCCCCCCC)C=C(C=C4)B5OC(C(O5)(C)C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |