For research use only. Not for therapeutic Use.
9’H-9,3′:6′,9”-Tercarbazole(Cat No.:L010975)is a polycyclic aromatic compound with a unique structure consisting of three fused carbazole units. This compound is of significant interest in materials science, particularly in the development of organic semiconductors, OLEDs (organic light-emitting diodes), and other electronic devices. Its extended conjugated system imparts excellent charge transport properties, making it a valuable material for optoelectronic applications. Additionally, 9’H-9,3′:6′,9”-Tercarbazole is used in the synthesis of advanced functional materials, contributing to the research and development of high-performance electronic devices.
CAS Number | 606129-90-2 |
Molecular Formula | C36H23N3 |
Purity | ≥95% |
IUPAC Name | 3,6-di(carbazol-9-yl)-9H-carbazole |
InChI | InChI=1S/C36H23N3/c1-5-13-33-25(9-1)26-10-2-6-14-34(26)38(33)23-17-19-31-29(21-23)30-22-24(18-20-32(30)37-31)39-35-15-7-3-11-27(35)28-12-4-8-16-36(28)39/h1-22,37H |
InChIKey | OGDZAJUZGODBKX-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC5=C(C=C4)NC6=C5C=C(C=C6)N7C8=CC=CC=C8C9=CC=CC=C97 |