For research use only. Not for therapeutic Use.
9H-Carbazol-1-amine(Cat No.:M082598)is a versatile compound used in pharmaceutical, organic, and material science research. Featuring an amine group attached to a carbazole core, this compound is crucial in synthesizing a variety of complex molecules, including potential therapeutic agents and advanced materials. Its structure allows for diverse chemical modifications, making it valuable in medicinal chemistry for drug development and in the creation of organic semiconductors and dyes. This compound supports innovative research in developing new therapies and cutting-edge technologies, contributing to advancements in multiple scientific fields.
CAS Number | 18992-86-4 |
Molecular Formula | C12H10N2 |
Purity | ≥95% |
IUPAC Name | 9H-carbazol-1-amine |
InChI | InChI=1S/C12H10N2/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,14H,13H2 |
InChIKey | YJKJAYFKPIUBAW-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)N |