For research use only. Not for therapeutic Use.
9H-carbazol-1-ol (Cat.No:L004041) is a significant chemical compound with versatile applications. Its distinctive structure, featuring a carbazole scaffold, imparts unique reactivity and properties. This compound serves as a crucial building block in the synthesis of specialized materials and pharmaceuticals. Its diverse applications span across industries, including electronics, pharmaceuticals, and materials science.
Catalog Number | L004041 |
CAS Number | 61601-54-5 |
Molecular Formula | C12H9NO |
Purity | ≥95% |
IUPAC Name | 9H-carbazol-1-ol |
InChI | InChI=1S/C12H9NO/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,13-14H |
InChIKey | QBPAUIDFWFXLKB-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)O |