For research use only. Not for therapeutic Use.
9H-Carbazole-3-sulfonyl chloride(Cat No.:L007162), is a chemical compound. It consists of a carbazole ring with a sulfonyl chloride (-SO2Cl) group at the 3rd position. This compound is widely used in organic synthesis as a sulfonylating agent, enabling the introduction of sulfonyl groups into various organic molecules. Its reactivity and versatility make it valuable for creating complex organic compounds, such as pharmaceuticals and agrochemicals. Researchers and chemists employ 9H-Carbazole-3-sulfonyl chloride as a key reagent, contributing to advancements in chemical research and the development of specialized organic molecules for various applications.
CAS Number | 21421-43-2 |
Molecular Formula | C12H8ClNO2S |
Purity | ≥95% |
IUPAC Name | 9H-carbazole-3-sulfonyl chloride |
InChI | InChI=1S/C12H8ClNO2S/c13-17(15,16)8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7,14H |
InChIKey | YZPNVCJKKPZEIA-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)S(=O)(=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |