For research use only. Not for therapeutic Use.
9H-Fluorene-3-carbaldehyde(Cat No.:L007503), is a chemical compound with a molecular structure consisting of a fluorene backbone (a polycyclic aromatic hydrocarbon) and an aldehyde functional group at the 3rd position. This compound finds applications in organic synthesis, serving as a versatile intermediate in the preparation of various organic molecules, including pharmaceuticals, dyes, and polymers. Its unique structure and reactivity make it valuable for creating complex compounds. Researchers and chemists use 9H-fluorene-3-carbaldehyde as a key building block, enabling the synthesis of diverse chemical entities and contributing to advancements in medicinal chemistry and materials science.
CAS Number | 83323-19-7 |
Molecular Formula | C14H10O |
Purity | ≥95% |
IUPAC Name | 9H-fluorene-3-carbaldehyde |
InChI | InChI=1S/C14H10O/c15-9-10-5-6-12-8-11-3-1-2-4-13(11)14(12)7-10/h1-7,9H,8H2 |
InChIKey | CYDABVPVQMWWBC-UHFFFAOYSA-N |
SMILES | C1C2=C(C=C(C=C2)C=O)C3=CC=CC=C31 |