For research use only. Not for therapeutic Use.
9H-Fluorene-9-methanol (Cat.No:M235194) is a chemical compound derived from fluorene. It features a hydroxyl group, making it valuable in organic synthesis for creating various molecules. This compound is used in pharmaceuticals, agrochemicals, and material science research, contributing to the development of diverse functional compounds.
CAS Number | 24324-17-2 |
Molecular Formula | C14H12O |
Purity | ≥95% |
IUPAC Name | 9H-fluoren-9-ylmethanol |
InChI | InChI=1S/C14H12O/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14-15H,9H2 |
InChIKey | XXSCONYSQQLHTH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CO |