For research use only. Not for therapeutic Use.
A-1210477（Cat No.:I002181） is a highly potent and selective inhibitor of MCL-1, a protein that plays a crucial role in promoting cancer cell survival. With a Ki value of 0.45 nM, A-1210477 exhibits a strong affinity for MCL-1. By specifically binding to MCL-1, it disrupts the protein’s function and leads to the induction of cancer cell apoptosis or programmed cell death. The apoptotic effect of A-1210477 is dependent on the presence of MCL-1, making it a promising candidate for targeted cancer therapy aimed at inhibiting MCL-1-mediated cell survival mechanisms.
| Catalog Number | I002181 |
| CAS Number | 1668553-26-1 |
| Synonyms | 7-(5-((4-(4-(N,N-dimethylsulfamoyl)piperazin-1-yl)phenoxy)methyl)-1,3-dimethyl-1H-pyrazol-4-yl)-1-(2-morpholinoethyl)-3-(3-(naphthalen-1-yloxy)propyl)-1H-indole-2-carboxylic acid |
| Molecular Formula | C₄₆H₅₅N₇O₇S |
| Purity | ≥95% |
| Target | Bcl-2 Family |
| Solubility | DMSO: ＜ 4.8 mg/mL |
| Storage | Store at -20°C |
| IC50 | 0.45 nM (Ki) |
| IUPAC Name | 7-[5-[[4-[4-(dimethylsulfamoyl)piperazin-1-yl]phenoxy]methyl]-1,3-dimethylpyrazol-4-yl]-1-(2-morpholin-4-ylethyl)-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
| InChI | InChI=1S/C46H55N7O7S/c1-33-43(41(49(4)47-33)32-60-36-19-17-35(18-20-36)51-22-24-52(25-23-51)61(56,57)48(2)3)40-14-8-13-38-39(15-9-29-59-42-16-7-11-34-10-5-6-12-37(34)42)45(46(54)55)53(44(38)40)26-21-50-27-30-58-31-28-50/h5-8,10-14,16-20H,9,15,21-32H2,1-4H3,(H,54,55) |
| InChIKey | XMVAWGSQPHFXKU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C2=CC=CC3=C2N(C(=C3CCCOC4=CC=CC5=CC=CC=C54)C(=O)O)CCN6CCOCC6)COC7=CC=C(C=C7)N8CCN(CC8)S(=O)(=O)N(C)C)C |
| Reference | <p style=/line-height:25px/> |
