For research use only. Not for therapeutic Use.
A 77-01(CAT: I004289) is a potent inhibitor targeting the TGF-β type I receptor superfamily activin-like kinase ALK5, displaying an impressive IC50 value of 25 nM. This compound’s ability to selectively block ALK5 activity holds the potential for modulating TGF-β signaling pathways, making it a valuable tool for studying the complex roles of TGF-β in various biological processes and diseases. A 77-01’s specific mechanism of action on ALK5 inhibition may contribute to advancing our understanding of TGF-β-related pathways and potentially offering new avenues for therapeutic interventions.
| Catalog Number | I004289 |
| CAS Number | 607737-87-1 |
| Synonyms | 4-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]quinoline |
| Molecular Formula | C18H14N4 |
| Purity | ≥95% |
| Target | TGF-βR1(ALK5) |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 25 nM [1] |
| InChI | InChI=1S/C18H14N4/c1-12-5-4-8-17(21-12)18-15(11-20-22-18)13-9-10-19-16-7-3-2-6-14(13)16/h2-11H,1H3,(H,20,22) |
| InChIKey | KJTYZDORHCDZPS-UHFFFAOYSA-N |
| SMILES | CC1=NC(C2=NNC=C2C3=CC=NC4=C3C=CC=C4)=CC=C1 |
| Reference | 1:Klin Padiatr. 1981 May;193(3):137-44. [All 77-01 therapy study for treatment of acute lymphocytic leukemia in childhood (author/’s transl)].Haas RJ,Janka G,Netzel B,Helmig M, PMID: 6943386 DOI: 10.1055/s-2008-1034449 |
