For research use only. Not for therapeutic Use.
A-804598(Cat No.:I000476)is a small-molecule inhibitor that selectively targets the protein kinase N (PKN), which plays a critical role in regulating cell signaling, cytoskeletal organization, and various cellular processes, including cell survival and proliferation. By inhibiting PKN, A-804598 has shown potential in preclinical studies for modulating pathways involved in cancer cell growth, metastasis, and inflammation. It is being explored for its therapeutic potential in cancer treatment, particularly in cancers where PKN activity is dysregulated. A-804598’s specific action on PKN makes it a promising candidate for targeted therapy in oncology.
CAS Number | 1125758-85-1 |
Molecular Formula | C19H17N5 |
Purity | ≥95% |
Target | P2X Receptor |
Solubility | DMSO: ≥ 32 mg/mL |
Storage | Store at -20C |
IUPAC Name | 1-cyano-2-[(1S)-1-phenylethyl]-3-quinolin-5-ylguanidine |
InChI | InChI=1S/C19H17N5/c1-14(15-7-3-2-4-8-15)23-19(22-13-20)24-18-11-5-10-17-16(18)9-6-12-21-17/h2-12,14H,1H3,(H2,22,23,24)/t14-/m0/s1 |
InChIKey | PQYCRDPLPKGSME-AWEZNQCLSA-N |
SMILES | C[C@@H](C1=CC=CC=C1)N=C(NC#N)NC2=CC=CC3=C2C=CC=N3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |