For research use only. Not for therapeutic Use.
α-Endosulfan-d4 is a deuterated organochlorine insecticide essential for advanced environmental and biochemical research. Featuring four deuterium atoms, it provides enhanced stability and precision in mass spectrometry and NMR spectroscopy. This isotopically labeled analog is crucial for studying the environmental fate, toxicology, and metabolic pathways of endosulfan. It ensures accurate quantification and reliable analytical results, making it an ideal standard for high-precision research in environmental science, pesticide residue analysis, and the investigation of degradation processes and ecological impacts of organochlorine compounds.
CAS Number | 203645-57-2 |
Molecular Formula | C9H6Cl6O3S |
Purity | ≥95% |
Storage | RT |
InChI | InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2/t3-,4+,7-,8+,19?/i1D2,2D2 |
InChIKey | RDYMFSUJUZBWLH-WWUWEAHGSA-N |
SMILES | C1C2C(COS(=O)O1)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |