For research use only. Not for therapeutic Use.
A-L-Idopyranose, Pentaacetate(Cat No.:M124349)is a specialized carbohydrate derivative used in chemical and biochemical research. This compound, featuring an acetylated idopyranose sugar, is important in the synthesis of complex oligosaccharides and glycosides. Its pentaacetate form enhances stability and reactivity, making it a valuable intermediate in the study of carbohydrate chemistry. It is particularly useful in the development of new therapeutic agents and in exploring the role of carbohydrates in biological processes, contributing to advancements in medicinal chemistry and glycoscience research.
CAS Number | 16299-15-3 |
Molecular Formula | C16H22O11 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2S,3R,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
InChI | InChI=1S/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13+,14-,15+,16+/m0/s1 |
InChIKey | LPTITAGPBXDDGR-ZVDSWSACSA-N |
SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |