For research use only. Not for therapeutic Use.
α-Methylstyrene polymer (Cat.No:R069899) is a polymer derived from α-methylstyrene, a derivative of styrene. It exhibits enhanced thermal stability and chemical resistance compared to regular styrene-based polymers. This makes α-Methylstyrene polymer valuable in applications where resistance to heat and chemicals is crucial, such as in the production of specialized coatings and adhesives.
Catalog Number | R069899 |
CAS Number | 25014-31-7 |
Synonyms | Poly(a-methylstyrene) |
Molecular Formula | C9H10 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | prop-1-en-2-ylbenzene |
InChI | InChI=1S/C9H10/c1-8(2)9-6-4-3-5-7-9/h3-7H,1H2,2H3 |
InChIKey | XYLMUPLGERFSHI-UHFFFAOYSA-N |
SMILES | CC(=C)C1=CC=CC=C1 |