For research use only. Not for therapeutic Use.
α-Naphthyl acetate is an organic compound commonly used as a substrate in enzymatic activity assays, particularly for the detection of esterases. In such assays, esterases hydrolyze α-naphthyl acetate, releasing naphthol, which can be coupled with a dye to produce a colored product, making it useful for histochemical staining and enzyme studies. This compound is also employed in organic synthesis and biochemical research as an intermediate. Its relatively simple structure, featuring an acetate ester attached to a naphthalene ring, allows for easy manipulation in chemical reactions, making it valuable for various analytical applications.
CAS Number | 830-81-9 |
Synonyms | 1-Naphthyl acetate |
Molecular Formula | C12H10O2 |
Purity | ≥95% |
Target | Cholinesterase (ChE) |
Storage | RT |
IUPAC Name | naphthalen-1-yl acetate |
InChI | InChI=1S/C12H10O2/c1-9(13)14-12-8-4-6-10-5-2-3-7-11(10)12/h2-8H,1H3 |
InChIKey | VGKONPUVOVVNSU-UHFFFAOYSA-N |
SMILES | CC(=O)OC1=CC=CC2=CC=CC=C21 |