For research use only. Not for therapeutic Use.
A12B4C3(Cat No.:I011099)is likely a coded designation for a specific compound, molecule, or reagent, typically used in scientific research or pharmaceutical development. Alphanumeric names like A12B4C3 are often employed to represent investigational drugs, chemical entities, or specific formulations under study. The exact nature of A12B4C3 would depend on its structure, properties, and intended application, such as its role in medical treatments, biochemical studies, or experimental research. It may be associated with areas such as peptide synthesis, enzyme inhibition, or therapeutic interventions in various disease areas, though further context is needed for a precise definition.
CAS Number | 1005129-80-5 |
Synonyms | 2-(1-hydroxyundecyl)-1-(4-nitroanilino)-6-phenyl-4a,7a-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
Molecular Formula | C30H38N4O5 |
Purity | ≥95% |
IUPAC Name | 2-(1-hydroxyundecyl)-1-(4-nitroanilino)-6-phenyl-4a,7a-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
InChI | InChI=1S/C30H38N4O5/c1-2-3-4-5-6-7-8-12-15-27(35)26-21-20-25-28(30(37)32(29(25)36)23-13-10-9-11-14-23)33(26)31-22-16-18-24(19-17-22)34(38)39/h9-11,13-14,16-21,25-28,31,35H,2-8,12,15H2,1H3 |
InChIKey | KVHGJAKTBPFFNV-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCC(C1C=CC2C(N1NC3=CC=C(C=C3)[N+](=O)[O-])C(=O)N(C2=O)C4=CC=CC=C4)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |