For research use only. Not for therapeutic Use.
A18-Iso5-2DC18（Cat No.:I041310）is a specialized chemical compound used in research to study lipid metabolism and cellular signaling. This molecule consists of a modified fatty acid structure that can be incorporated into cell membranes, allowing researchers to track lipid interactions and dynamics within cells. By incorporating specific chemical modifications, A18-Iso5-2DC18 can influence lipid-related pathways, providing insight into processes like cell growth, differentiation, and apoptosis. It is often used in experimental settings to study the role of lipids in various diseases, including cancer and neurodegenerative disorders, offering a potential avenue for therapeutic development.
| CAS Number | 2412492-09-0 |
| Synonyms | ethyl 1-[3-(2-ethylpiperidin-1-yl)propyl]-5,5-bis[(Z)-heptadec-8-enyl]-2H-imidazole-2-carboxylate |
| Molecular Formula | C50H93N3O2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 1-[3-(2-ethylpiperidin-1-yl)propyl]-5,5-bis[(Z)-heptadec-8-enyl]-2H-imidazole-2-carboxylate |
| InChI | InChI=1S/C50H93N3O2/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-36-41-50(42-37-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2)46-51-48(49(54)55-8-4)53(50)45-39-44-52-43-38-35-40-47(52)7-3/h21-24,46-48H,5-20,25-45H2,1-4H3/b23-21-,24-22- |
| InChIKey | FJUINRMQOFNLCW-SXAUZNKPSA-N |
| SMILES | CCCCCCCC/C=C\CCCCCCCC1(N(C(N=C1)C(=O)OCC)CCCN2C(CCCC2)CC)CCCCCCC/C=C\CCCCCCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
