For research use only. Not for therapeutic Use.
AA-T3A-C12(Cat No.:I041415)is a synthetic compound featuring a structure designed to interact with cellular receptors and enzymes, primarily focusing on modulating immune and inflammatory pathways. It contains a unique combination of amino acid sequences and a C12 alkyl chain, enhancing its stability and bioactivity. This compound is being investigated for its potential applications in treating various inflammatory and autoimmune diseases by modulating T-cell responses and cytokine production. Preclinical studies are ongoing to evaluate its therapeutic potential, pharmacokinetics, and safety profile, with hopes of addressing conditions such as rheumatoid arthritis and multiple sclerosis.
CAS Number | 2938207-23-7 |
Synonyms | N-[3-[bis[3-[bis(2-hydroxydodecyl)amino]propyl]amino]propyl]-4-methoxybenzamide |
Molecular Formula | C65H126N4O6 |
Purity | ≥95% |
IUPAC Name | N-[3-[bis[3-[bis(2-hydroxydodecyl)amino]propyl]amino]propyl]-4-methoxybenzamide |
InChI | InChI=1S/C65H126N4O6/c1-6-10-14-18-22-26-30-34-41-60(70)55-68(56-61(71)42-35-31-27-23-19-15-11-7-2)53-39-51-67(50-38-49-66-65(74)59-45-47-64(75-5)48-46-59)52-40-54-69(57-62(72)43-36-32-28-24-20-16-12-8-3)58-63(73)44-37-33-29-25-21-17-13-9-4/h45-48,60-63,70-73H,6-44,49-58H2,1-5H3,(H,66,74) |
InChIKey | ADWWRKPNPJUOGO-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCC(CN(CCCN(CCCNC(=O)C1=CC=C(C=C1)OC)CCCN(CC(CCCCCCCCCC)O)CC(CCCCCCCCCC)O)CC(CCCCCCCCCC)O)O |