For research use only, not for therapeutic use.
AA147（Cat No.:I018131）is a small-molecule activator of the unfolded protein response (UPR), specifically targeting the ATF6 pathway. It promotes cellular protection mechanisms by enhancing protein folding capacity and reducing the accumulation of misfolded proteins in the endoplasmic reticulum (ER). AA147 has shown potential in treating diseases associated with ER stress, such as neurodegenerative disorders and cardiovascular diseases. By selectively activating the ATF6 branch of the UPR, AA147 helps restore ER homeostasis without triggering apoptosis, making it a valuable tool for therapeutic research in protein misfolding diseases.
| Catalog Number | I018131 |
| CAS Number | 393121-74-9 |
| Molecular Formula | C₁₆H₁₇NO₂ |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-(2-hydroxy-5-methylphenyl)-3-phenylpropanamide |
| InChI | InChI=1S/C16H17NO2/c1-12-7-9-15(18)14(11-12)17-16(19)10-8-13-5-3-2-4-6-13/h2-7,9,11,18H,8,10H2,1H3,(H,17,19) |
| InChIKey | AWHLTHOHBAGPMY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)NC(=O)CCC2=CC=CC=C2 |
| Reference | [1]. Christina COOLEY, et al. Regulators of the endoplasmic reticulum proteostasis network. WO2017117430A1. |
