For research use only. Not for therapeutic Use.
AA41612（Cat No.:I012857）is a selective small molecule inhibitor targeting a specific protein kinase involved in cancer cell proliferation and survival. By inhibiting this kinase, AA41612 disrupts key signaling pathways that drive tumor growth, making it a promising candidate for cancer treatment. Preclinical studies have shown its potential in blocking the progression of various cancers, including solid tumors and hematological malignancies. AA41612’s targeted action offers a strategy to minimize side effects commonly seen with traditional chemotherapy, positioning it as a potential therapeutic agent in oncology drug development.
| CAS Number | 433690-62-1 |
| Synonyms | 1-(2,5-dichloro-4-methoxyphenyl)sulfonylpiperidine |
| Molecular Formula | C12H15Cl2NO3S |
| Purity | ≥95% |
| IUPAC Name | 1-(2,5-dichloro-4-methoxyphenyl)sulfonylpiperidine |
| InChI | InChI=1S/C12H15Cl2NO3S/c1-18-11-7-10(14)12(8-9(11)13)19(16,17)15-5-3-2-4-6-15/h7-8H,2-6H2,1H3 |
| InChIKey | FEMVYIQDVGQFBA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1Cl)S(=O)(=O)N2CCCCC2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
