For research use only. Not for therapeutic Use.
AA92593 (Cat No.: I012855) is a selective antagonist of the melanin-concentrating hormone receptor 1 (MCHR1), involved in regulating appetite, energy homeostasis, and mood. By blocking MCHR1, AA92593 has been studied for its potential in treating obesity, metabolic disorders, and certain psychiatric conditions. It helps reduce food intake and body weight in preclinical models without significantly affecting locomotor activity. As a research tool, AA92593 aids in understanding MCHR1-related signaling pathways and evaluating therapeutic strategies targeting energy balance, feeding behavior, and mood regulation.
| CAS Number | 457961-34-1 |
| Synonyms | 1-(4-Methoxy-3-methyl-benzenesulfonyl)-piperidine |
| Molecular Formula | C13H19NO3S |
| Purity | ≥95% |
| IUPAC Name | 1-(4-methoxy-3-methylphenyl)sulfonylpiperidine |
| InChI | InChI=1S/C13H19NO3S/c1-11-10-12(6-7-13(11)17-2)18(15,16)14-8-4-3-5-9-14/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | HDTKLZINZGEPFG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)N2CCCCC2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
