For research use only. Not for therapeutic Use.
ABBV-318（Cat No.:I043691）is an investigational monoclonal antibody being developed for the treatment of autoimmune and inflammatory diseases. It works by targeting specific immune system receptors involved in the regulation of inflammatory responses, aiming to reduce excessive immune activation. Through this mechanism, ABBV-318 has shown potential in managing conditions such as rheumatoid arthritis and lupus. Preclinical and clinical trials are exploring its safety and efficacy in modulating immune cell activity and mitigating inflammation. ABBV-318 represents a promising therapeutic approach in the field of immunology and autoimmune disease management.
| CAS Number | 1802848-94-7 |
| Synonyms | [(3R)-3-fluoropyrrolidin-1-yl]-[6-[5-(trifluoromethyl)pyridin-2-yl]oxyquinolin-2-yl]methanone |
| Molecular Formula | C20H15F4N3O2 |
| Purity | ≥95% |
| IUPAC Name | [(3R)-3-fluoropyrrolidin-1-yl]-[6-[5-(trifluoromethyl)pyridin-2-yl]oxyquinolin-2-yl]methanone |
| InChI | InChI=1S/C20H15F4N3O2/c21-14-7-8-27(11-14)19(28)17-4-1-12-9-15(3-5-16(12)26-17)29-18-6-2-13(10-25-18)20(22,23)24/h1-6,9-10,14H,7-8,11H2/t14-/m1/s1 |
| InChIKey | FWLFRXVPNVBXGR-CQSZACIVSA-N |
| SMILES | C1CN(C[C@@H]1F)C(=O)C2=NC3=C(C=C2)C=C(C=C3)OC4=NC=C(C=C4)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
