For research use only. Not for therapeutic Use.
ABC294640（Cat No.:I005460）is a selective inhibitor of sphingosine kinase 2 (SK2), an enzyme involved in the production of sphingosine-1-phosphate (S1P), a lipid mediator that plays a role in regulating immune responses, cell growth, and survival. By inhibiting SK2, ABC294640 reduces S1P signaling, which can help control inflammation, tumor progression, and fibrosis. It has been studied for its potential in treating cancer, autoimmune diseases, and fibrotic disorders. Preclinical studies have shown promise in reducing tumor growth and improving immune responses, though clinical trials are ongoing to assess its safety and efficacy in humans.
| Catalog Number | I005460 |
| CAS Number | 915385-81-8 |
| Synonyms | ABC-294640 |
| Molecular Formula | C₂₃H₂₅ClN₂O |
| Purity | ≥95% |
| Target | Sphingosine Kinase-2 |
| Solubility | DMSO: ≥ 3.7 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)adamantane-1-carboxamide |
| InChI | InChI=1S/C23H25ClN2O/c24-20-3-1-19(2-4-20)22-10-17-9-18(11-22)13-23(12-17,15-22)21(27)26-14-16-5-7-25-8-6-16/h1-8,17-18H,9-15H2,(H,26,27) |
| InChIKey | CAOTVXGYTWCKQE-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C(=O)NCC4=CC=NC=C4)C5=CC=C(C=C5)Cl |
