For research use only. Not for therapeutic Use.
ABN401（Cat No.:I043535）is a chemical compound under investigation for its potential therapeutic applications, particularly in the field of cancer research. It is a selective inhibitor targeting specific molecular pathways involved in tumor growth and progression. ABN401 works by modulating certain proteins or enzymes that are crucial for the survival and proliferation of cancer cells. Due to its targeted mechanism of action, it holds promise as a treatment option with fewer side effects compared to conventional therapies. Ongoing studies aim to evaluate its efficacy, safety, and potential for clinical use in oncology.
| CAS Number | 2242563-15-9 |
| Synonyms | 4-[5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrimidin-2-yl]-2-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]morpholine |
| Molecular Formula | C29H34N12O |
| Purity | ≥95% |
| IUPAC Name | 4-[5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrimidin-2-yl]-2-[[5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazin-3-yl]methyl]morpholine |
| InChI | InChI=1S/C29H34N12O/c1-37-7-9-39(10-8-37)17-21-3-5-22(6-4-21)23-13-31-29(32-14-23)40-11-12-42-25(19-40)20-41-28-27(35-36-41)30-16-26(34-28)24-15-33-38(2)18-24/h3-6,13-16,18,25H,7-12,17,19-20H2,1-2H3 |
| InChIKey | PQJGYYZYYMVBDF-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C3=CN=C(N=C3)N4CCOC(C4)CN5C6=NC(=CN=C6N=N5)C7=CN(N=C7)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
