For research use only. Not for therapeutic Use.
Abridin（Cat No.:C001145）, derived from Bisnorcholenaldehyde and isolated from Abrus precatorius seed extracts, serves various research purposes. It can be used to synthesize 27-Nor-Δ4-dafachronic acid, acting as a synthetic ligand for Caenorhabditis elegans DAF-12 receptor. Additionally, it is involved in the synthesis of 3b,6a-dihydroxy-5a-cholan-23-one. Abridin is related to the parent compound Progesterone, a steroid hormone that induces maturation and secretory activity of the uterine endothelium, playing a vital role in the female reproductive system.
| Catalog Number | C001145 |
| CAS Number | 73030-56-5 |
| Synonyms | (22E)-26,27-Dinorcholesta-4,22-diene-3,24-dione; |
| Molecular Formula | C₂₅H₃₆O₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| InChI | 1S/C25H36O2/c1-16(5-6-17(2)26)21-9-10-22-20-8-7-18-15-19(27)11-13-24(18,3)23(20)12-14-25(21,22)4/h5-6,15-16,20-23H,7-14H2,1-4H3/b6-5+/t16-,20+,21-,22+,23+,24+,25-/m1/s1 |
| InChIKey | CIPWTUUCAJDQRQ-XIGLMXCVSA-N |
| SMILES | C[C@H](/C=C/C(=O)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C |
