For research use only. Not for therapeutic Use.
Abrucomstat（Cat No.:I021226） is a compound that acts as an inhibitor of methyl coenzyme M reductase (MCR). MCR is an enzyme involved in methanogenesis, the process of methane production. By inhibiting MCR, abrucomstat has the potential to disrupt methane production, which may have therapeutic implications. Methane-producing microorganisms, such as methanogenic bacteria, are associated with various health conditions, including gastrointestinal disorders.
| Catalog Number | I021226 |
| CAS Number | 100502-66-7 |
| Synonyms | Abrucomstat |
| Molecular Formula | C3H7NO4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Store at -20°C |
| IUPAC Name | 3-hydroxypropyl nitrate |
| InChI | InChI=1S/C3H7NO4/c5-2-1-3-8-4(6)7/h5H,1-3H2 |
| InChIKey | PTMLFFXFTRSBJW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCCCO |
