For research use only. Not for therapeutic Use.
(+)-Abscisic Aldehyde(CAT: R019475) is a chemical compound associated with the plant hormone abscisic acid (ABA). It is a natural component found in plants and plays a crucial role in various physiological processes, including seed dormancy, stress responses, and plant growth regulation. (+)-Abscisic Aldehyde is a precursor to ABA, and its conversion to ABA is a significant step in the ABA biosynthesis pathway. ABA is known for its involvement in the regulation of plant responses to environmental stress, such as drought and salinity.
Catalog Number | R019475 |
CAS Number | 41944-86-9 |
Synonyms | (2Z,4E)-5-[(1S)-1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl]-3-methyl-2,4-pentadienal; (+)-Abscisyl aldehyde; Abscisic Aldehyde |
Molecular Formula | C15H20O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienal |
InChI | InChI=1S/C15H20O3/c1-11(6-8-16)5-7-15(18)12(2)9-13(17)10-14(15,3)4/h5-9,18H,10H2,1-4H3/b7-5+,11-6-/t15-/m1/s1 |
InChIKey | RIKWDZWVHUIUAM-KICRZJJPSA-N |
SMILES | CC1=CC(=O)CC(C1(C=CC(=CC=O)C)O)(C)C |