For research use only. Not for therapeutic Use.
ABT-384(Cat No.:I000847)is a potent and selective inhibitor of the enzyme 11β-hydroxysteroid dehydrogenase type 1 (11β-HSD1). This enzyme converts inactive cortisone into active cortisol, a stress hormone involved in various metabolic processes. By inhibiting 11β-HSD1, ABT-384 reduces cortisol levels, offering potential therapeutic benefits for conditions related to excess cortisol, such as Cushing’s syndrome, metabolic syndrome, and type 2 diabetes. Additionally, ABT-384 has been investigated for its potential in treating cognitive impairment and Alzheimer’s disease, making it a promising candidate in the field of endocrinology and neurodegenerative research.
CAS Number | 868623-40-9 |
Synonyms | 4-[[2-methyl-2-[4-[5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]propanoyl]amino]adamantane-1-carboxamide |
Molecular Formula | C25H34F3N5O2 |
Purity | ≥95% |
IUPAC Name | 4-[[2-methyl-2-[4-[5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]propanoyl]amino]adamantane-1-carboxamide |
InChI | InChI=1S/C25H34F3N5O2/c1-23(2,33-7-5-32(6-8-33)19-4-3-18(14-30-19)25(26,27)28)22(35)31-20-16-9-15-10-17(20)13-24(11-15,12-16)21(29)34/h3-4,14-17,20H,5-13H2,1-2H3,(H2,29,34)(H,31,35) |
InChIKey | CLHMYBJIOZXCEX-UHFFFAOYSA-N |
SMILES | CC(C)(C(=O)NC1C2CC3CC1CC(C3)(C2)C(=O)N)N4CCN(CC4)C5=NC=C(C=C5)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |