Ac-DEVD-CHO(CAT: M134470) is a chemical compound used in biological research and pharmaceutical studies. Its mode of action involves being a specific inhibitor of caspases, a group of protease enzymes involved in apoptosis (programmed cell death). Ac-DEVD-CHO is designed to selectively block caspase-3 activity, which plays a crucial role in apoptotic cell death. Researchers use it as a tool to investigate the mechanisms of apoptosis and to study the role of caspases in various cellular processes. Additionally, Ac-DEVD-CHO finds applications in drug development, particularly in the design and testing of potential caspase inhibitors for therapeutic purposes.
| Catalog Number | M134470 |
| CAS Number | 169332-60-9 |
| Molecular Formula | C₂₀H₃₀N₄O₁₁ |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C20H30N4O11/c1-9(2)17(20(35)22-11(8-25)6-15(29)30)24-18(33)12(4-5-14(27)28)23-19(34)13(7-16(31)32)21-10(3)26/h8-9,11-13,17H,4 |
| InChIKey | UMBVAPCONCILTL-MRHIQRDNSA-N |
| SMILES | CC(C)C(C(=O)NC(CC(=O)O)C=O)NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C |
