For research use only. Not for therapeutic Use.
Ac-DL-Trp-OH(Cat No.:I018195) is an endogenous metabolite derived from the amino acid tryptophan. It is a modified form of tryptophan with an acetyl group (Ac) attached to the amino group and a hydroxyl group (OH) attached to the carboxyl group. As an endogenous metabolite, Ac-DL-Trp-OH likely plays a role in various biological processes, including protein synthesis, neurotransmitter synthesis, and regulation of immune responses.
Catalog Number | I018195 |
CAS Number | 87-32-1 |
Molecular Formula | C₁₃H₁₄N₂O₃ |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | 2-8°C |
IUPAC Name | 2-acetamido-3-(1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18) |
InChIKey | DZTHIGRZJZPRDV-UHFFFAOYSA-N |
SMILES | CC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O |