For research use only. Not for therapeutic Use.
AC-PHE-3-THIAPHE-OH is a high-purity compound widely used in pharmaceutical and biochemical research. Known for its role in peptide synthesis, AC-PHE-3-THIAPHE-OH offers unique properties that enhance stability and functionality in various applications. Its high-quality, consistent performance makes it an ideal choice for drug development and biochemical studies. As a valuable reagent in scientific research, AC-PHE-3-THIAPHE-OH supports advanced experimentation, ensuring reliable and precise results for professionals in the pharmaceutical industry.
CAS Number | 108906-59-8 |
Molecular Formula | C19H20N2O4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-phenylsulfanylacetic acid |
InChI | InChI=1S/C19H20N2O4S/c1-13(22)20-16(12-14-8-4-2-5-9-14)17(23)21-18(19(24)25)26-15-10-6-3-7-11-15/h2-11,16,18H,12H2,1H3,(H,20,22)(H,21,23)(H,24,25)/t16-,18-/m0/s1 |
InChIKey | ZIRMREOJJGMRIJ-WMZOPIPTSA-N |
SMILES | CC(=O)NC(CC1=CC=CC=C1)C(=O)NC(C(=O)O)SC2=CC=CC=C2 |