For research use only. Not for therapeutic Use.
AC-SER-ASP-LYS-PRO-OH is a synthetic tetrapeptide composed of serine (SER), aspartic acid (ASP), lysine (LYS), and proline (PRO), with an acetyl group (AC) at the N-terminus and a free carboxyl group (OH) at the C-terminus. This peptide is often used in biochemical research for studying protein interactions, enzyme activity, or cellular signaling pathways. Its sequence can be tailored to mimic specific protein motifs, making it valuable in drug development and understanding biological processes such as cell adhesion, immune responses, or receptor binding.
CAS Number | 127103-11-1 |
Molecular Formula | C20H33N5O9 |
Purity | ≥95% |
Target | Angiotensin-converting Enzyme (ACE) |
Storage | Desiccate at +4C |
IUPAC Name | 1-[2-[[2-[(2-acetamido-3-hydroxypropanoyl)amino]-3-carboxypropanoyl]amino]-6-aminohexanoyl]pyrrolidine-2-carboxylic acid |
InChI | 1S/C20H33N5O9/c1-11(27)22-14(10-26)18(31)24-13(9-16(28)29)17(30)23-12(5-2-3-7-21)19(32)25-8-4-6-15(25)20(33)34/h12-15,26H,2-10,21H2,1H3,(H,22,27)(H,23,30)(H,24,31)(H,28,29)(H,33,34) |
InChIKey | HJDRXEQUFWLOGJ-UHFFFAOYSA-N |
SMILES | CC(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O |