For research use only. Not for therapeutic Use.
AC-TRP-3,5-Bis(trifluoromethyl)benzyl ester is a synthetic derivative of tryptophan, an essential amino acid, used in pharmaceutical research and peptide synthesis. The presence of the 3,5-bis(trifluoromethyl)benzyl ester group enhances its stability and lipophilicity, making it valuable in the design of bioactive molecules. This compound is commonly used in the development of peptide-based drugs, enzyme inhibitors, and other therapeutic agents. Its modified structure allows for better pharmacokinetic properties, contributing to advancements in medicinal chemistry and drug discovery.
Catalog Number | M095423 |
CAS Number | 148451-96-1 |
Synonyms | (S)-3,5-bis(trifluoromethyl)benzyl 2-acetamido-3-(1H-indol-3-yl)propanoate |
Molecular Formula | C22H18F6N2O3 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at RT |
IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate |
InChI | InChI=1S/C22H18F6N2O3/c1-12(31)30-19(8-14-10-29-18-5-3-2-4-17(14)18)20(32)33-11-13-6-15(21(23,24)25)9-16(7-13)22(26,27)28/h2-7,9-10,19,29H,8,11H2,1H3,(H,30,31)/t19-/m0/s1 |
InChIKey | BYYQYXVAWXAYQC-IBGZPJMESA-N |
SMILES | CC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)OCC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |