For research use only. Not for therapeutic Use.
Ac-WLA-AMC（Cat No.:I042958）is a fluorogenic peptide substrate commonly used in enzyme assays to study protease activity. The compound consists of an acetyl group (Ac) attached to the N-terminus of the peptide sequence WLA, which is linked to the fluorescent reporter 7-amino-4-methylcoumarin (AMC). Upon cleavage of the peptide bond by specific proteases, the AMC group is released, producing fluorescence that can be detected and quantified. Ac-WLA-AMC is often used in research to investigate protease activity, screen for inhibitors, and study enzyme kinetics, providing valuable insights into protease function in various biological processes.
| CAS Number | 1104011-59-7 |
| Synonyms | (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-4-methyl-N-[(2S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopropan-2-yl]pentanamide |
| Molecular Formula | C32H37N5O6 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-4-methyl-N-[(2S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopropan-2-yl]pentanamide |
| InChI | InChI=1S/C32H37N5O6/c1-17(2)12-26(37-32(42)27(35-20(5)38)14-21-16-33-25-9-7-6-8-24(21)25)31(41)34-19(4)30(40)36-22-10-11-23-18(3)13-29(39)43-28(23)15-22/h6-11,13,15-17,19,26-27,33H,12,14H2,1-5H3,(H,34,41)(H,35,38)(H,36,40)(H,37,42)/t19-,26-,27-/m0/s1 |
| InChIKey | PIJMRHCPKXLMIS-DOYMOWJKSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
