For research use only. Not for therapeutic Use.
AC-YVAD-CMK(Cat No.:M045409)is a synthetic peptide inhibitor used in research to study caspase-1 activity. It consists of the sequence YVAD, a specific recognition site for caspase-1, and is conjugated to a fluoromethylketone (CMK), which covalently binds to the active site of the enzyme, inhibiting its function. Caspase-1 is crucial in the inflammatory response and the activation of the inflammasome. AC-YVAD-CMK is commonly used to explore its role in inflammation, pyroptosis, and immune responses, as well as to evaluate potential therapies targeting caspase-1 in diseases like autoinflammatory disorders.
CAS Number | 178603-78-6 |
Synonyms | N-Ac-Tyr-Val-Ala-Asp-CMK |
Molecular Formula | C24H33ClN4O8 |
Purity | ≥95% |
Target | Caspase |
Storage | -20°C |
IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-5-chloro-4-oxopentanoic acid |
InChI | InChI=1S/C24H33ClN4O8/c1-12(2)21(24(37)26-13(3)22(35)28-17(10-20(33)34)19(32)11-25)29-23(36)18(27-14(4)30)9-15-5-7-16(31)8-6-15/h5-8,12-13,17-18,21,31H,9-11H2,1-4H3,(H,26,37)(H,27,30)(H,28,35)(H,29,36)(H,33,34)/t13-,17-,18-,21-/m0/s1 |
InChIKey | UOUBHJRCKHLGFB-DGJUNBOTSA-N |
SMILES | C[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)CCl)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)C |