For research use only. Not for therapeutic Use.
AC430 (Cat No.: I001025) is a small-molecule inhibitor that selectively targets Janus kinase (JAK) signaling pathways, particularly JAK2. It is used in research to study inflammatory diseases, autoimmune disorders, and cancers driven by aberrant JAK-STAT signaling. By inhibiting JAK2 activity, AC430 suppresses cytokine-mediated cell proliferation and immune responses. Its potential therapeutic applications include treating myeloproliferative disorders and other JAK2-dependent malignancies. AC430 serves as a valuable tool in understanding signal transduction mechanisms and exploring targeted therapies for immune-related and hematological diseases.
| CAS Number | 1361415-84-0 |
| Molecular Formula | C19H16FN5O |
| Purity | ≥95% |
| Target | JAK2 inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°Cfor short term (days to weeks), or -20 °C for long term (months). |
| IUPAC Name | (S)-(4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]methanol |
| InChI | InChI=1S/C19H16FN5O/c1-11-10-16(25-24-11)22-18-14-4-2-3-5-15(14)21-19(23-18)17(26)12-6-8-13(20)9-7-12/h2-10,17,26H,1H3,(H2,21,22,23,24,25)/t17-/m0/s1 |
| InChIKey | DCRWIATZWHLIPN-KRWDZBQOSA-N |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC3=CC=CC=C32)C(C4=CC=C(C=C4)F)O |
| Reference | </br> </br> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
