For research use only. Not for therapeutic Use.
Acedoben（Cat No.:R058457） is an acetylated derivative of p-aminobenzoic acid and serves as a metabolite of the anesthetic benzocaine. It is formed through the enzymatic acetylation of p-aminobenzoic acid. Acedoben has been identified as a urinary metabolite following the administration of benzocaine, indicating its role in the metabolism and elimination of the anesthetic from the body. Understanding the metabolic pathways of benzocaine, including the formation of acedoben, contributes to our knowledge of drug metabolism and potential interactions with other substances in the body.
| Catalog Number | R058457 |
| CAS Number | 556-08-1 |
| Synonyms | 4-(Acetylamino)benzoic Acid; 4-Acetamidobenzoic Acid; 4’-Carboxyacetanilide; N-Acetyl-p-aminobenzoic Acid; NSC 4002; p-(Acetoamino)benzoic Acid; p-(Acetylamino)benzoic Acid; p-Acetamidobenzoic Acid; p-Acetaminobenzoic Acid; |
| Molecular Formula | C9H9NO3 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 4-acetamidobenzoic acid |
| InChI | InChI=1S/C9H9NO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) |
| InChIKey | QCXJEYYXVJIFCE-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)O |
