For research use only. Not for therapeutic Use.
Aceglutamide(Cat No.:I002844) is a psychostimulant and nootropic compound known for its potential to enhance memory and concentration. It acts by modulating neurotransmitter activity in the brain, particularly affecting glutamate receptors. Aceglutamide is believed to enhance cognitive function by promoting neuronal communication and synaptic plasticity. It has been studied for its potential applications in improving cognitive performance, memory retention, and focus.
CAS Number | 2490-97-3 |
Molecular Formula | C7H12N2O4 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO:13mg/mL |
Storage | 2-8°C |
IUPAC Name | (2S)-2-acetamido-5-amino-5-oxopentanoic acid |
InChI | InChI=1S/C7H12N2O4/c1-4(10)9-5(7(12)13)2-3-6(8)11/h5H,2-3H2,1H3,(H2,8,11)(H,9,10)(H,12,13)/t5-/m0/s1 |
InChIKey | KSMRODHGGIIXDV-YFKPBYRVSA-N |
SMILES | CC(=O)NC(CCC(=O)N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |