For research use only. Not for therapeutic Use.
Acelarin(CAT: I005033) (NUC-1031) is a next-generation chemotherapy drug, a nucleotide analog, developed to improve upon the limitations of traditional nucleoside analogs like gemcitabine. It is designed to bypass the resistance mechanisms that reduce the effectiveness of conventional chemotherapy, allowing for greater stability and efficient uptake into cancer cells. Once inside the cells, Acelarin is incorporated into DNA, disrupting cell replication and causing cancer cell death. It has shown potential in treating advanced solid tumors, including pancreatic, biliary tract, and ovarian cancers. Acelarin is a promising therapeutic agent for overcoming resistance in cancer treatment and improving patient outcomes.
| Catalog Number | I005033 |
| CAS Number | 840506-29-8 |
| Synonyms | benzyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| Molecular Formula | C25H27F2N4O8P |
| Purity | ≥95% |
| InChI | InChI=1S/C25H27F2N4O8P/c1-16(22(33)36-14-17-8-4-2-5-9-17)30-40(35,39-18-10-6-3-7-11-18)37-15-19-21(32)25(26,27)23(38-19)31-13-12-20(28)29-24(31)34/h2-13,16,19,21,23,32H,14-15H2,1H3,(H,30,35)(H2,28,29,34)/t16-,19+,21+,23+,40?/m0/s1 |
| InChIKey | NHTKGYOMICWFQZ-KKQYNPQSSA-N |
| SMILES | CC(C(=O)OCC1=CC=CC=C1)NP(=O)(OCC2C(C(C(O2)N3C=CC(=NC3=O)N)(F)F)O)OC4=CC=CC=C4 |
