For research use only. Not for therapeutic Use.
Acenaphthene-d10 is a fully deuterated version of acenaphthene, a polycyclic aromatic hydrocarbon (PAH). The ten deuterium atoms replace all hydrogen atoms in the molecule, making it an ideal internal standard for analytical techniques such as gas chromatography-mass spectrometry (GC-MS) in environmental and chemical analysis. This deuterated compound is primarily used in research to monitor and quantify the presence of PAHs in environmental samples, such as soil, water, and air, due to its stable isotopic properties. Its applications are crucial in environmental chemistry, organic synthesis, and studies related to the behavior of PAHs in various environments.
CAS Number | 15067-26-2 |
Molecular Formula | C12H10 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,1,2,2,3,4,5,6,7,8-decadeuterioacenaphthylene |
InChI | InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2/i1D,2D,3D,4D,5D,6D,7D2,8D2 |
InChIKey | CWRYPZZKDGJXCA-WHUVPORUSA-N |
SMILES | [2H]C1=C(C2=C3C(=C1[2H])C(C(C3=C(C(=C2[2H])[2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |