For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">Acenaphthylene (CAS 208-96-8) <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">has been used to investigate the photodimerization of acenaphthylene in micellar and hydrogel media.</span></span></span></span>
| Catalog Number | R049362 |
| CAS Number | 208-96-8 |
| Synonyms | Cyclopenta[de]naphthalene; NSC 59821; Acenaphthyene; |
| Molecular Formula | C12H8 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20°C |
| IUPAC Name | acenaphthylene |
| InChI | InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H |
| InChIKey | HXGDTGSAIMULJN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC3=CC=C2 |
| Reference | 1.<span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Bhat, Shreedhar, and Uday Maitra. "Hydrogels as reaction vessels: Acenaphthylene dimerization in hydrogels derived from bile acid analogues." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Molecules</i><span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;"> 12.9 (2007): 2181-2189.</span> |
